C21H23N3O4S2 — CID 110554637
4-[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzenesulfonamide (PubChem CID 110554637) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110554637 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-[3-(3,5-dimethylpiperidin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzenesulfonamide |
| SMILES | CC1CC(C)CN(C2=C(c3cccs3)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)C1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-13-10-14(2)12-23(11-13)19-18(17-4-3-9-29-17)20(25)24(21(19)26)15-5-7-16(8-6-15)30(22,27)28/h3-9,13-14H,10-12H2,1-2H3,(H2,22,27,28) |
| InChIKey | MYSFCFWCWTUZEI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|