C21H21ClN2O3S — CID 110554038
1-(3-chloro-4-methoxyphenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554038) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554038 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(c3cccs3)=C(N3CCCC(C)C3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O3S/c1-13-5-3-9-23(12-13)19-18(17-6-4-10-28-17)20(25)24(21(19)26)14-7-8-16(27-2)15(22)11-14/h4,6-8,10-11,13H,3,5,9,12H2,1-2H3 |
| InChIKey | MIJOUDDLBZUASV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|