C20H18Cl2N2O2S — CID 110555576
1-(2,3-dichlorophenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555576) has the molecular formula C20H18Cl2N2O2S and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555576 |
| Molecular Formula | C20H18Cl2N2O2S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CC1CCCN(C2=C(c3cccs3)C(=O)N(c3cccc(Cl)c3Cl)C2=O)C1 |
| InChI | InChI=1S/C20H18Cl2N2O2S/c1-12-5-3-9-23(11-12)18-16(15-8-4-10-27-15)19(25)24(20(18)26)14-7-2-6-13(21)17(14)22/h2,4,6-8,10,12H,3,5,9,11H2,1H3 |
| InChIKey | SCVAFKXUTMVZEZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|