C20H14N2O4S3 — CID 110554649
4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)benzenesulfonamide (PubChem CID 110554649) has the molecular formula C20H14N2O4S3 and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)benzenesulfonamide.
| Compound Name | 4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110554649 |
| Molecular Formula | C20H14N2O4S3 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)C(Sc3ccccc3)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C20H14N2O4S3/c21-29(25,26)15-10-8-13(9-11-15)22-19(23)17(16-7-4-12-27-16)18(20(22)24)28-14-5-2-1-3-6-14/h1-12H,(H2,21,25,26) |
| InChIKey | BNUWXPSANXTPLM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|