C21H12F3NO2S2 — CID 110554086
3-phenylsulfanyl-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110554086) has the molecular formula C21H12F3NO2S2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 3-phenylsulfanyl-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-phenylsulfanyl-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554086 |
| Molecular Formula | C21H12F3NO2S2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-phenylsulfanyl-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(Sc2ccccc2)=C(c2cccs2)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H12F3NO2S2/c22-21(23,24)13-6-4-7-14(12-13)25-19(26)17(16-10-5-11-28-16)18(20(25)27)29-15-8-2-1-3-9-15/h1-12H |
| InChIKey | XQCMUIHMXVOYBX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|