C24H17F3N2O2S — CID 110554069
3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110554069) has the molecular formula C24H17F3N2O2S and a molecular weight of 454.47 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554069 |
| Molecular Formula | C24H17F3N2O2S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2cccs2)=C(N2CCc3ccccc3C2)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F3N2O2S/c25-24(26,27)17-7-3-8-18(13-17)29-22(30)20(19-9-4-12-32-19)21(23(29)31)28-11-10-15-5-1-2-6-16(15)14-28/h1-9,12-13H,10-11,14H2 |
| InChIKey | YNSHWEFSIUFKQK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|