C22H23N3O4S — CID 110561194
4-[3-(3-methylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide (PubChem CID 110561194) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[3-(3-methylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(3-methylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110561194 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[3-(3-methylpiperidin-1-yl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
| SMILES | CC1CCCN(C2=C(c3ccccc3)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)C1 |
| InChI | InChI=1S/C22H23N3O4S/c1-15-6-5-13-24(14-15)20-19(16-7-3-2-4-8-16)21(26)25(22(20)27)17-9-11-18(12-10-17)30(23,28)29/h2-4,7-12,15H,5-6,13-14H2,1H3,(H2,23,28,29) |
| InChIKey | HDAOBINSLZNZSC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|