C29H26N4O2 — CID 110596038
4-[3-[4-(4-methylpiperidin-1-yl)anilino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzonitrile (PubChem CID 110596038) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-[3-[4-(4-methylpiperidin-1-yl)anilino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-[4-(4-methylpiperidin-1-yl)anilino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110596038 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-[3-[4-(4-methylpiperidin-1-yl)anilino]-2,5-dioxo-4-phenylpyrrol-1-yl]benzonitrile |
| SMILES | CC1CCN(c2ccc(NC3=C(c4ccccc4)C(=O)N(c4ccc(C#N)cc4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C29H26N4O2/c1-20-15-17-32(18-16-20)24-13-9-23(10-14-24)31-27-26(22-5-3-2-4-6-22)28(34)33(29(27)35)25-11-7-21(19-30)8-12-25/h2-14,20,31H,15-18H2,1H3 |
| InChIKey | MQEBJVDWRHVZHC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|