C30H31N3O2 — CID 110600616
1-benzyl-3-(4-methylphenyl)-4-[4-(4-methylpiperidin-1-yl)anilino]pyrrole-2,5-dione (PubChem CID 110600616) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-benzyl-3-(4-methylphenyl)-4-[4-(4-methylpiperidin-1-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(4-methylphenyl)-4-[4-(4-methylpiperidin-1-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110600616 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-benzyl-3-(4-methylphenyl)-4-[4-(4-methylpiperidin-1-yl)anilino]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Nc3ccc(N4CCC(C)CC4)cc3)C(=O)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H31N3O2/c1-21-8-10-24(11-9-21)27-28(30(35)33(29(27)34)20-23-6-4-3-5-7-23)31-25-12-14-26(15-13-25)32-18-16-22(2)17-19-32/h3-15,22,31H,16-20H2,1-2H3 |
| InChIKey | MNPILDVBWOCBBC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|