C28H25N3O4 — CID 110594318
1-(1,3-benzodioxol-5-ylmethyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione (PubChem CID 110594318) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594318 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-phenyl-4-(4-pyrrolidin-1-ylanilino)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc(N3CCCC3)cc2)=C(c2ccccc2)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H25N3O4/c32-27-25(20-6-2-1-3-7-20)26(29-21-9-11-22(12-10-21)30-14-4-5-15-30)28(33)31(27)17-19-8-13-23-24(16-19)35-18-34-23/h1-3,6-13,16,29H,4-5,14-15,17-18H2 |
| InChIKey | GZNDHVXPYBWHGJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|