C23H21FN2O4 — CID 110543387
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110543387) has the molecular formula C23H21FN2O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543387 |
| Molecular Formula | C23H21FN2O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCCCC2)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H21FN2O4/c24-17-7-5-16(6-8-17)20-21(25-10-2-1-3-11-25)23(28)26(22(20)27)13-15-4-9-18-19(12-15)30-14-29-18/h4-9,12H,1-3,10-11,13-14H2 |
| InChIKey | NXCGBQURNCKKFB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|