C21H20FN3O2 — CID 110543524
3-(4-fluorophenyl)-4-piperidin-1-yl-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione (PubChem CID 110543524) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-piperidin-1-yl-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-4-piperidin-1-yl-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543524 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-(4-fluorophenyl)-4-piperidin-1-yl-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCCCC2)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C21H20FN3O2/c22-17-8-6-16(7-9-17)18-19(24-11-2-1-3-12-24)21(27)25(20(18)26)14-15-5-4-10-23-13-15/h4-10,13H,1-3,11-12,14H2 |
| InChIKey | JIFDMXOECQKTTF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|