C17H19FN2O2 — CID 110543715
3-(4-fluorophenyl)-1-propyl-4-pyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 110543715) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-propyl-4-pyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1-propyl-4-pyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543715 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-propyl-4-pyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccc(F)cc2)=C(N2CCCC2)C1=O |
| InChI | InChI=1S/C17H19FN2O2/c1-2-9-20-16(21)14(12-5-7-13(18)8-6-12)15(17(20)22)19-10-3-4-11-19/h5-8H,2-4,9-11H2,1H3 |
| InChIKey | DLQKSMJOZFFGOG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|