C24H25FN2O3 — CID 110555785
1-[2-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110555785) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555785 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCCCC3)C(=O)N(CCc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25FN2O3/c1-30-20-11-7-18(8-12-20)21-22(26-14-3-2-4-15-26)24(29)27(23(21)28)16-13-17-5-9-19(25)10-6-17/h5-12H,2-4,13-16H2,1H3 |
| InChIKey | ZQQOYIOUTJETGD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|