C25H27FN2O4 — CID 110543257
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110543257) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543257 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C(c3ccc(F)cc3)=C(N3CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C25H27FN2O4/c1-31-20-11-6-17(16-21(20)32-2)12-15-28-24(29)22(18-7-9-19(26)10-8-18)23(25(28)30)27-13-4-3-5-14-27/h6-11,16H,3-5,12-15H2,1-2H3 |
| InChIKey | CZABOTHSZDTXHM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|