C26H31N3O4 — CID 110563846
3-(3,4-dimethoxyphenyl)-4-(4-ethylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 110563846) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-(4-ethylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-(4-ethylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110563846 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-(4-ethylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(OC)c(OC)c3)C(=O)N(CCc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C26H31N3O4/c1-4-27-14-16-28(17-15-27)24-23(20-10-11-21(32-2)22(18-20)33-3)25(30)29(26(24)31)13-12-19-8-6-5-7-9-19/h5-11,18H,4,12-17H2,1-3H3 |
| InChIKey | HDPZWRVGBFXHHP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|