C25H20N2O5 — CID 110594328
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione (PubChem CID 110594328) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594328 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3ccccc3)C(=O)N(Cc3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C25H20N2O5/c1-30-19-10-8-18(9-11-19)26-23-22(17-5-3-2-4-6-17)24(28)27(25(23)29)14-16-7-12-20-21(13-16)32-15-31-20/h2-13,26H,14-15H2,1H3 |
| InChIKey | MWFIGUFYUNMURQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|