C25H28N4O4 — CID 110585117
3-[4-(4-methylpiperidin-1-yl)anilino]-4-(4-nitrophenyl)-1-propylpyrrole-2,5-dione (PubChem CID 110585117) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[4-(4-methylpiperidin-1-yl)anilino]-4-(4-nitrophenyl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-[4-(4-methylpiperidin-1-yl)anilino]-4-(4-nitrophenyl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110585117 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[4-(4-methylpiperidin-1-yl)anilino]-4-(4-nitrophenyl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(Nc2ccc(N3CCC(C)CC3)cc2)=C(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C25H28N4O4/c1-3-14-28-24(30)22(18-4-8-21(9-5-18)29(32)33)23(25(28)31)26-19-6-10-20(11-7-19)27-15-12-17(2)13-16-27/h4-11,17,26H,3,12-16H2,1-2H3 |
| InChIKey | BIJUGLWZLOLAGM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|