C23H25ClN4O2 — CID 110599265
3-(4-chlorophenyl)-1-ethyl-4-[4-(4-methylpiperazin-1-yl)anilino]pyrrole-2,5-dione (PubChem CID 110599265) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-ethyl-4-[4-(4-methylpiperazin-1-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-ethyl-4-[4-(4-methylpiperazin-1-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110599265 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-(4-chlorophenyl)-1-ethyl-4-[4-(4-methylpiperazin-1-yl)anilino]pyrrole-2,5-dione |
| SMILES | CCN1C(=O)C(Nc2ccc(N3CCN(C)CC3)cc2)=C(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H25ClN4O2/c1-3-28-22(29)20(16-4-6-17(24)7-5-16)21(23(28)30)25-18-8-10-19(11-9-18)27-14-12-26(2)13-15-27/h4-11,25H,3,12-15H2,1-2H3 |
| InChIKey | ILKGENNPJKHVHY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|