C27H34N4O3 — CID 110587753
3-(4-ethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-propylpyrrole-2,5-dione (PubChem CID 110587753) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587753 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(Nc2ccc(N3CCN(CC)CC3)cc2)=C(c2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C27H34N4O3/c1-4-15-31-26(32)24(20-7-13-23(14-8-20)34-6-3)25(27(31)33)28-21-9-11-22(12-10-21)30-18-16-29(5-2)17-19-30/h7-14,28H,4-6,15-19H2,1-3H3 |
| InChIKey | PGFFLGQYLUURPF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|