C25H29ClN4O3 — CID 110599324
3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-(2-methoxyethyl)pyrrole-2,5-dione (PubChem CID 110599324) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-(2-methoxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-(2-methoxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110599324 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-(2-methoxyethyl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(c2ccc(NC3=C(c4ccc(Cl)cc4)C(=O)N(CCOC)C3=O)cc2)CC1 |
| InChI | InChI=1S/C25H29ClN4O3/c1-3-28-12-14-29(15-13-28)21-10-8-20(9-11-21)27-23-22(18-4-6-19(26)7-5-18)24(31)30(25(23)32)16-17-33-2/h4-11,27H,3,12-17H2,1-2H3 |
| InChIKey | MGOOHNSQOHJLOJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|