C25H27ClN4O2 — CID 110599512
3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110599512) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110599512 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[4-(4-ethylpiperazin-1-yl)anilino]-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2ccc(N3CCN(CC)CC3)cc2)=C(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H27ClN4O2/c1-3-13-30-24(31)22(18-5-7-19(26)8-6-18)23(25(30)32)27-20-9-11-21(12-10-20)29-16-14-28(4-2)15-17-29/h3,5-12,27H,1,4,13-17H2,2H3 |
| InChIKey | BRHOUYANEZPQJQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|