C23H24N2O3 — CID 110588013
3-(4-ethoxyphenyl)-4-(4-ethylanilino)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110588013) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-(4-ethylanilino)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyphenyl)-4-(4-ethylanilino)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588013 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-(4-ethylanilino)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2ccc(CC)cc2)=C(c2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C23H24N2O3/c1-4-15-25-22(26)20(17-9-13-19(14-10-17)28-6-3)21(23(25)27)24-18-11-7-16(5-2)8-12-18/h4,7-14,24H,1,5-6,15H2,2-3H3 |
| InChIKey | KOKREIMEVKGMEP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|