C22H19N3O2 — CID 110561903
4-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)benzonitrile (PubChem CID 110561903) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)benzonitrile.
| Compound Name | 4-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 110561903 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-(2,5-dioxo-3-phenyl-4-piperidin-1-ylpyrrol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(c3ccccc3)=C(N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C22H19N3O2/c23-15-16-9-11-18(12-10-16)25-21(26)19(17-7-3-1-4-8-17)20(22(25)27)24-13-5-2-6-14-24/h1,3-4,7-12H,2,5-6,13-14H2 |
| InChIKey | ROWYRWVITHNZEU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|