C24H23N3O3 — CID 110547979
4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-piperidin-1-ylpyrrol-1-yl]benzonitrile (PubChem CID 110547979) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-piperidin-1-ylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-piperidin-1-ylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110547979 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-piperidin-1-ylpyrrol-1-yl]benzonitrile |
| SMILES | CCOc1ccc(C2=C(N3CCCCC3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-2-30-20-12-8-18(9-13-20)21-22(26-14-4-3-5-15-26)24(29)27(23(21)28)19-10-6-17(16-25)7-11-19/h6-13H,2-5,14-15H2,1H3 |
| InChIKey | BLHQOMFQHVQVKQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|