C18H21N3O2 — CID 138976955
1-phenyl-3,4-dipyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 138976955) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-phenyl-3,4-dipyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-phenyl-3,4-dipyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 138976955 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-phenyl-3,4-dipyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | O=C1C(N2CCCC2)=C(N2CCCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c22-17-15(19-10-4-5-11-19)16(20-12-6-7-13-20)18(23)21(17)14-8-2-1-3-9-14/h1-3,8-9H,4-7,10-13H2 |
| InChIKey | NZDQOMOVVNCSLY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|