C21H23NO2S2 — CID 110553510
3-benzylsulfanyl-1-hexyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553510) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-hexyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-1-hexyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553510 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-benzylsulfanyl-1-hexyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(SCc2ccccc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C21H23NO2S2/c1-2-3-4-8-13-22-20(23)18(17-12-9-14-25-17)19(21(22)24)26-15-16-10-6-5-7-11-16/h5-7,9-12,14H,2-4,8,13,15H2,1H3 |
| InChIKey | IXQCHZMOIORRGM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|