C23H24FNO2S — CID 110544256
3-benzylsulfanyl-4-(4-fluorophenyl)-1-hexylpyrrole-2,5-dione (PubChem CID 110544256) has the molecular formula C23H24FNO2S and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-(4-fluorophenyl)-1-hexylpyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-4-(4-fluorophenyl)-1-hexylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544256 |
| Molecular Formula | C23H24FNO2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-benzylsulfanyl-4-(4-fluorophenyl)-1-hexylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(SCc2ccccc2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C23H24FNO2S/c1-2-3-4-8-15-25-22(26)20(18-11-13-19(24)14-12-18)21(23(25)27)28-16-17-9-6-5-7-10-17/h5-7,9-14H,2-4,8,15-16H2,1H3 |
| InChIKey | ZXRREMKMHIQAFG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|