C19H25NO2S — CID 110572963
3-ethylsulfanyl-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110572963) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-ethylsulfanyl-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572963 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-ethylsulfanyl-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(SCC)=C(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C19H25NO2S/c1-4-6-7-8-13-20-18(21)16(17(19(20)22)23-5-2)15-11-9-14(3)10-12-15/h9-12H,4-8,13H2,1-3H3 |
| InChIKey | LKUJBCDKPSYRDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|