C22H23NO2S — CID 110572382
3-benzylsulfanyl-1-butyl-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110572382) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-butyl-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-1-butyl-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572382 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-benzylsulfanyl-1-butyl-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCN1C(=O)C(SCc2ccccc2)=C(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C22H23NO2S/c1-3-4-14-23-21(24)19(18-12-10-16(2)11-13-18)20(22(23)25)26-15-17-8-6-5-7-9-17/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | WCPHSLNCLJFLLI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|