C25H29NO4S — CID 110575648
3-benzylsulfanyl-1-(3-ethoxypropyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110575648) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-(3-ethoxypropyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-1-(3-ethoxypropyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575648 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-benzylsulfanyl-1-(3-ethoxypropyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(SCc2ccccc2)=C(c2ccc(OC(C)C)cc2)C1=O |
| InChI | InChI=1S/C25H29NO4S/c1-4-29-16-8-15-26-24(27)22(20-11-13-21(14-12-20)30-18(2)3)23(25(26)28)31-17-19-9-6-5-7-10-19/h5-7,9-14,18H,4,8,15-17H2,1-3H3 |
| InChIKey | AMQOHGNVCVIHCI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|