C18H22FNO3S — CID 110544382
1-(3-ethoxypropyl)-3-(4-fluorophenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione (PubChem CID 110544382) has the molecular formula C18H22FNO3S and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(4-fluorophenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(3-ethoxypropyl)-3-(4-fluorophenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544382 |
| Molecular Formula | C18H22FNO3S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(4-fluorophenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(SC(C)C)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H22FNO3S/c1-4-23-11-5-10-20-17(21)15(13-6-8-14(19)9-7-13)16(18(20)22)24-12(2)3/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | PGQIIFJDRXLWOP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|