C15H15ClFNO3 — CID 110580816
3-chloro-1-(3-ethoxypropyl)-4-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110580816) has the molecular formula C15H15ClFNO3 and a molecular weight of 311.74 g/mol. Its IUPAC name is 3-chloro-1-(3-ethoxypropyl)-4-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3-ethoxypropyl)-4-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580816 |
| Molecular Formula | C15H15ClFNO3 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-chloro-1-(3-ethoxypropyl)-4-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(Cl)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H15ClFNO3/c1-2-21-9-3-8-18-14(19)12(13(16)15(18)20)10-4-6-11(17)7-5-10/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | SBMGVLNOPDAZSE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|