C16H17ClFNO3 — CID 110580805
3-chloro-4-(4-fluorophenyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione (PubChem CID 110580805) has the molecular formula C16H17ClFNO3 and a molecular weight of 325.77 g/mol. Its IUPAC name is 3-chloro-4-(4-fluorophenyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-fluorophenyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580805 |
| Molecular Formula | C16H17ClFNO3 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-chloro-4-(4-fluorophenyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
| SMILES | CC(C)OCCCN1C(=O)C(Cl)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H17ClFNO3/c1-10(2)22-9-3-8-19-15(20)13(14(17)16(19)21)11-4-6-12(18)7-5-11/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | NMHPOKRWOZHANP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|