C20H27NO5 — CID 110584735
3-hydroxy-4-[4-(2-methylpropoxy)phenyl]-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione (PubChem CID 110584735) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-hydroxy-4-[4-(2-methylpropoxy)phenyl]-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-hydroxy-4-[4-(2-methylpropoxy)phenyl]-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584735 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-hydroxy-4-[4-(2-methylpropoxy)phenyl]-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(O)C(=O)N(CCCOC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C20H27NO5/c1-13(2)12-26-16-8-6-15(7-9-16)17-18(22)20(24)21(19(17)23)10-5-11-25-14(3)4/h6-9,13-14,22H,5,10-12H2,1-4H3 |
| InChIKey | UHPAAYFVPLOVMB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|