C19H25NO3S — CID 110546566
1-butyl-3-(4-ethoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione (PubChem CID 110546566) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-butyl-3-(4-ethoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-butyl-3-(4-ethoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110546566 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-butyl-3-(4-ethoxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
| SMILES | CCCCN1C(=O)C(SC(C)C)=C(c2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C19H25NO3S/c1-5-7-12-20-18(21)16(17(19(20)22)24-13(3)4)14-8-10-15(11-9-14)23-6-2/h8-11,13H,5-7,12H2,1-4H3 |
| InChIKey | NSQXMYUJKOCOGF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|