C18H23NO3S — CID 110551306
1-methyl-3-[4-(2-methylpropoxy)phenyl]-4-propan-2-ylsulfanylpyrrole-2,5-dione (PubChem CID 110551306) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-methyl-3-[4-(2-methylpropoxy)phenyl]-4-propan-2-ylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-methyl-3-[4-(2-methylpropoxy)phenyl]-4-propan-2-ylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551306 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-methyl-3-[4-(2-methylpropoxy)phenyl]-4-propan-2-ylsulfanylpyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(SC(C)C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-11(2)10-22-14-8-6-13(7-9-14)15-16(23-12(3)4)18(21)19(5)17(15)20/h6-9,11-12H,10H2,1-5H3 |
| InChIKey | CKMRKZLAOXXRFR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|