C22H20N2O3S — CID 110548003
4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzonitrile (PubChem CID 110548003) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110548003 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[3-(4-ethoxyphenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzonitrile |
| SMILES | CCOc1ccc(C2=C(SC(C)C)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-4-27-18-11-7-16(8-12-18)19-20(28-14(2)3)22(26)24(21(19)25)17-9-5-15(13-23)6-10-17/h5-12,14H,4H2,1-3H3 |
| InChIKey | FPNZKFVJPAWHHR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|