C24H26FNO3S — CID 110576358
1-[2-(4-fluorophenyl)ethyl]-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110576358) has the molecular formula C24H26FNO3S and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110576358 |
| Molecular Formula | C24H26FNO3S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(SC(C)C)C(=O)N(CCc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H26FNO3S/c1-4-15-29-20-11-7-18(8-12-20)21-22(30-16(2)3)24(28)26(23(21)27)14-13-17-5-9-19(25)10-6-17/h5-12,16H,4,13-15H2,1-3H3 |
| InChIKey | RLMKKLJYDKVMSJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|