C22H22FNO4S — CID 110576982
1-[(4-fluorophenyl)methyl]-3-(2-hydroxyethylsulfanyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110576982) has the molecular formula C22H22FNO4S and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2-hydroxyethylsulfanyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2-hydroxyethylsulfanyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110576982 |
| Molecular Formula | C22H22FNO4S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2-hydroxyethylsulfanyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(SCCO)C(=O)N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H22FNO4S/c1-2-12-28-18-9-5-16(6-10-18)19-20(29-13-11-25)22(27)24(21(19)26)14-15-3-7-17(23)8-4-15/h3-10,25H,2,11-14H2,1H3 |
| InChIKey | BDTYTTUFQUDJGS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|