C21H23NO4S — CID 110576483
1-(furan-2-ylmethyl)-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110576483) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(furan-2-ylmethyl)-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110576483 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-propan-2-ylsulfanyl-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(SC(C)C)C(=O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-4-11-25-16-9-7-15(8-10-16)18-19(27-14(2)3)21(24)22(20(18)23)13-17-6-5-12-26-17/h5-10,12,14H,4,11,13H2,1-3H3 |
| InChIKey | ZXUOLCYXWJQDOE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|