C27H34N2O4 — CID 110575615
1-(3-butoxypropyl)-3-(N-methylanilino)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110575615) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(N-methylanilino)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-(N-methylanilino)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575615 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(N-methylanilino)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(c2ccc(OC(C)C)cc2)=C(N(C)c2ccccc2)C1=O |
| InChI | InChI=1S/C27H34N2O4/c1-5-6-18-32-19-10-17-29-26(30)24(21-13-15-23(16-14-21)33-20(2)3)25(27(29)31)28(4)22-11-8-7-9-12-22/h7-9,11-16,20H,5-6,10,17-19H2,1-4H3 |
| InChIKey | YNXDXJCTWUPRKY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|