C29H30N2O3 — CID 110574909
3-(N-ethylanilino)-1-(2-phenylethyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110574909) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-(N-ethylanilino)-1-(2-phenylethyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(N-ethylanilino)-1-(2-phenylethyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110574909 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-(N-ethylanilino)-1-(2-phenylethyl)-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CCN(C1=C(c2ccc(OC(C)C)cc2)C(=O)N(CCc2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C29H30N2O3/c1-4-30(24-13-9-6-10-14-24)27-26(23-15-17-25(18-16-23)34-21(2)3)28(32)31(29(27)33)20-19-22-11-7-5-8-12-22/h5-18,21H,4,19-20H2,1-3H3 |
| InChIKey | GFWQKOLLNQOLKI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|