C20H21NO4S — CID 110560147
1-(3-ethoxypropyl)-3-(furan-2-ylmethylsulfanyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110560147) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(furan-2-ylmethylsulfanyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(3-ethoxypropyl)-3-(furan-2-ylmethylsulfanyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560147 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(furan-2-ylmethylsulfanyl)-4-phenylpyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(SCc2ccco2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H21NO4S/c1-2-24-12-7-11-21-19(22)17(15-8-4-3-5-9-15)18(20(21)23)26-14-16-10-6-13-25-16/h3-6,8-10,13H,2,7,11-12,14H2,1H3 |
| InChIKey | IIMOEXQMITUADN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|