C21H23NO3S — CID 110578475
1-butyl-3-(2,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110578475) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-butyl-3-(2,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-butyl-3-(2,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578475 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-butyl-3-(2,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | CCCCN1C(=O)C(SCc2ccco2)=C(c2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C21H23NO3S/c1-4-5-10-22-20(23)18(17-9-8-14(2)12-15(17)3)19(21(22)24)26-13-16-7-6-11-25-16/h6-9,11-12H,4-5,10,13H2,1-3H3 |
| InChIKey | BMQXGNSFDCHQHR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|