C21H21Cl2NO4S — CID 110568407
3-(2,4-dichlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione (PubChem CID 110568407) has the molecular formula C21H21Cl2NO4S and a molecular weight of 454.38 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568407 |
| Molecular Formula | C21H21Cl2NO4S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
| SMILES | CC(C)OCCCN1C(=O)C(SCc2ccco2)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H21Cl2NO4S/c1-13(2)27-10-4-8-24-20(25)18(16-7-6-14(22)11-17(16)23)19(21(24)26)29-12-15-5-3-9-28-15/h3,5-7,9,11,13H,4,8,10,12H2,1-2H3 |
| InChIKey | OEEUEDCXWCKWIH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|