C22H29Cl2N3O3 — CID 110568398
3-(2,4-dichlorophenyl)-4-(4-ethylpiperazin-1-yl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione (PubChem CID 110568398) has the molecular formula C22H29Cl2N3O3 and a molecular weight of 454.40 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(4-ethylpiperazin-1-yl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(4-ethylpiperazin-1-yl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568398 |
| Molecular Formula | C22H29Cl2N3O3 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(4-ethylpiperazin-1-yl)-1-(3-propan-2-yloxypropyl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(Cl)cc3Cl)C(=O)N(CCCOC(C)C)C2=O)CC1 |
| InChI | InChI=1S/C22H29Cl2N3O3/c1-4-25-9-11-26(12-10-25)20-19(17-7-6-16(23)14-18(17)24)21(28)27(22(20)29)8-5-13-30-15(2)3/h6-7,14-15H,4-5,8-13H2,1-3H3 |
| InChIKey | ZVNYPWBKFIHXHJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|