C24H24Cl2N2O3 — CID 110568553
3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-ethoxypropyl)pyrrole-2,5-dione (PubChem CID 110568553) has the molecular formula C24H24Cl2N2O3 and a molecular weight of 459.37 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-ethoxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-ethoxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568553 |
| Molecular Formula | C24H24Cl2N2O3 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-ethoxypropyl)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C24H24Cl2N2O3/c1-2-31-14-6-13-28-23(29)21(18-11-10-17(25)15-19(18)26)22(24(28)30)27-12-5-8-16-7-3-4-9-20(16)27/h3-4,7,9-11,15H,2,5-6,8,12-14H2,1H3 |
| InChIKey | RKNKZDPMCKZGHP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|