C26H30N2O3 — CID 110566334
3-(3,4-dihydro-2H-quinolin-1-yl)-1-hexyl-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110566334) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-1-hexyl-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-hexyl-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566334 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-hexyl-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccccc2OC)=C(N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C26H30N2O3/c1-3-4-5-10-17-28-25(29)23(20-14-7-9-16-22(20)31-2)24(26(28)30)27-18-11-13-19-12-6-8-15-21(19)27/h6-9,12,14-16H,3-5,10-11,13,17-18H2,1-2H3 |
| InChIKey | XGUUFXDNIKDGLG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|