C27H32N2O2 — CID 110578990
3-(3,4-dihydro-2H-quinolin-1-yl)-4-(2,4-dimethylphenyl)-1-hexylpyrrole-2,5-dione (PubChem CID 110578990) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(2,4-dimethylphenyl)-1-hexylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(2,4-dimethylphenyl)-1-hexylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578990 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(2,4-dimethylphenyl)-1-hexylpyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(C)cc2C)=C(N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C27H32N2O2/c1-4-5-6-9-16-29-26(30)24(22-15-14-19(2)18-20(22)3)25(27(29)31)28-17-10-12-21-11-7-8-13-23(21)28/h7-8,11,13-15,18H,4-6,9-10,12,16-17H2,1-3H3 |
| InChIKey | YFPZFIDZKNUTHB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|